EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O4 |
| Net Charge | 0 |
| Average Mass | 360.494 |
| Monoisotopic Mass | 360.23006 |
| SMILES | CC/C=C\C/C=C\C/C=C\C=C\C(C/C=C\C/C=C\CCC(=O)O)OO |
| InChI | InChI=1S/C22H32O4/c1-2-3-4-5-6-7-8-9-12-15-18-21(26-25)19-16-13-10-11-14-17-20-22(23)24/h3-4,6-7,9,11-16,18,21,25H,2,5,8,10,17,19-20H2,1H3,(H,23,24)/b4-3-,7-6-,12-9-,14-11-,16-13-,18-15+ |
| InChIKey | YBZVZSNFGOPPCL-SKSHMZPZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4Z,7Z,11E,13Z,16Z,19Z)-10-hydroperoxydocosahexaenoic acid (CHEBI:136657) has functional parent all-cis-docosa-4,7,10,13,16,19-hexaenoic acid (CHEBI:28125) |
| (4Z,7Z,11E,13Z,16Z,19Z)-10-hydroperoxydocosahexaenoic acid (CHEBI:136657) is a docosanoid (CHEBI:131863) |
| (4Z,7Z,11E,13Z,16Z,19Z)-10-hydroperoxydocosahexaenoic acid (CHEBI:136657) is a hydroperoxy polyunsaturated fatty acid (CHEBI:189832) |
| (4Z,7Z,11E,13Z,16Z,19Z)-10-hydroperoxydocosahexaenoic acid (CHEBI:136657) is a long-chain fatty acid (CHEBI:15904) |
| (4Z,7Z,11E,13Z,16Z,19Z)-10-hydroperoxydocosahexaenoic acid (CHEBI:136657) is conjugate acid of (4Z,7Z,11E,13Z,16Z,19Z)-10-hydroperoxydocosahexaenoate (CHEBI:134057) |
| Incoming Relation(s) |
| (4Z,7Z,11E,13Z,16Z,19Z)-10-hydroperoxydocosahexaenoate (CHEBI:134057) is conjugate base of (4Z,7Z,11E,13Z,16Z,19Z)-10-hydroperoxydocosahexaenoic acid (CHEBI:136657) |
| IUPAC Name |
|---|
| (4Z,7Z,11E,13Z,16Z,19Z)-10-hydroperoxydocosa-4,7,11,13,16,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| 10-HPDoHE | ChEBI |
| 10-hydroperoxy-(4Z,7Z,11E,13Z,16Z,19Z)-docosahexaenoic acid | ChEBI |
| Citations |
|---|