EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31O9 |
| Net Charge | -1 |
| Average Mass | 463.503 |
| Monoisotopic Mass | 463.19736 |
| SMILES | [H][C@@]12CCc3cc(O[C@@H]4O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]4O)ccc3[C@@]1([H])CC[C@]1(C)[C@@H](O)[C@H](O)C[C@@]21[H] |
| InChI | InChI=1S/C24H32O9/c1-24-7-6-13-12-5-3-11(32-23-19(28)17(26)18(27)20(33-23)22(30)31)8-10(12)2-4-14(13)15(24)9-16(25)21(24)29/h3,5,8,13-21,23,25-29H,2,4,6-7,9H2,1H3,(H,30,31)/p-1/t13-,14-,15+,16-,17+,18+,19-,20+,21+,23-,24+/m1/s1 |
| InChIKey | UZKIAJMSMKLBQE-JRSYHJKYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| estriol 3-O-(β-D-glucuronide)(1−) (CHEBI:136649) is a steroid glucosiduronic acid anion (CHEBI:136637) |
| estriol 3-O-(β-D-glucuronide)(1−) (CHEBI:136649) is a β-D-glucosiduronate (CHEBI:83411) |
| estriol 3-O-(β-D-glucuronide)(1−) (CHEBI:136649) is conjugate base of estriol 3-O-(β-D-glucuronide) (CHEBI:45869) |
| Incoming Relation(s) |
| estriol 3-O-(β-D-glucuronide) (CHEBI:45869) is conjugate acid of estriol 3-O-(β-D-glucuronide)(1−) (CHEBI:136649) |
| IUPAC Name |
|---|
| (16α,17β)-16,17-dihydroxyestra-1,3,5(10)-trien-3-yl β-D-glucopyranosiduronate |
| Synonym | Source |
|---|---|
| 16α,17β-estriol 3-O-(β-D-glucuronide) (1−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 16α,17β-estriol 3-O-(β-D-glucuronate) | UniProt |
| Citations |
|---|