EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H35O8 |
| Net Charge | -1 |
| Average Mass | 463.547 |
| Monoisotopic Mass | 463.23374 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](O[C@@H]3O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]3O)CC[C@@]21[H] |
| InChI | InChI=1S/C25H36O8/c1-24-9-7-13(26)11-12(24)3-4-14-15-5-6-17(25(15,2)10-8-16(14)24)32-23-20(29)18(27)19(28)21(33-23)22(30)31/h11,14-21,23,27-29H,3-10H2,1-2H3,(H,30,31)/p-1/t14-,15-,16-,17-,18-,19-,20+,21-,23+,24-,25-/m0/s1 |
| InChIKey | NIKZPECGCSUSBV-HMAFJQTKSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| testosterone 17-O-(β-D-glucuronide)(1−) (CHEBI:136639) is a androstane conjugate (CHEBI:167106) |
| testosterone 17-O-(β-D-glucuronide)(1−) (CHEBI:136639) is a steroid glucosiduronic acid anion (CHEBI:136637) |
| testosterone 17-O-(β-D-glucuronide)(1−) (CHEBI:136639) is a β-D-glucosiduronate (CHEBI:83411) |
| testosterone 17-O-(β-D-glucuronide)(1−) (CHEBI:136639) is conjugate base of testosterone 17-glucosiduronic acid (CHEBI:28835) |
| Incoming Relation(s) |
| testosterone 17-glucosiduronic acid (CHEBI:28835) is conjugate acid of testosterone 17-O-(β-D-glucuronide)(1−) (CHEBI:136639) |
| IUPAC Name |
|---|
| 3-oxoandrost-4-en-17β-yl β-D-glucopyranosiduronate |
| UniProt Name | Source |
|---|---|
| testosterone 17-O-(β-D-glucuronate) | UniProt |
| Citations |
|---|