EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H36O3 |
| Net Charge | 0 |
| Average Mass | 300.483 |
| Monoisotopic Mass | 300.26645 |
| SMILES | CCCCCCCCCC(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h17,19H,2-16H2,1H3,(H,20,21) |
| InChIKey | RKHXDCVAPIMDMG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jodina rhombifolia (ncbitaxon:350583) | seed (BTO:0001226) | PubMed (AGR:IND20449206) | Found in seed oil |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-hydroxyoctadecanoic acid (CHEBI:136638) is a hydroxyoctadecanoic acid (CHEBI:24747) |
| 9-hydroxyoctadecanoic acid (CHEBI:136638) is conjugate acid of 9-hydroxyoctadecanoate (CHEBI:136286) |
| Incoming Relation(s) |
| 9-(octadecanoyloxy)octadecanoic acid (CHEBI:137097) has functional parent 9-hydroxyoctadecanoic acid (CHEBI:136638) |
| 9-[(9Z)-hexadecenoyloxy]octadecanoic acid (CHEBI:137084) has functional parent 9-hydroxyoctadecanoic acid (CHEBI:136638) |
| 9-[(9Z)-octadecenoyloxy]octadecanoic acid (CHEBI:136996) has functional parent 9-hydroxyoctadecanoic acid (CHEBI:136638) |
| 9-hydroxyoctadecanoate (CHEBI:136286) is conjugate base of 9-hydroxyoctadecanoic acid (CHEBI:136638) |
| IUPAC Name |
|---|
| 9-hydroxyoctadecanoic acid |
| Synonym | Source |
|---|---|
| 9-hydroxystearic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0061661 | HMDB |
| LMFA02000127 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1727304 | Reaxys |
| CAS:3384-24-5 | ChemIDplus |
| Citations |
|---|