EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29O8 |
| Net Charge | -1 |
| Average Mass | 445.488 |
| Monoisotopic Mass | 445.18679 |
| SMILES | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@]1([H])c3ccc(O[C@@H]4O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]4O)cc3CC[C@@]21[H] |
| InChI | InChI=1S/C24H30O8/c1-24-9-8-14-13-5-3-12(10-11(13)2-4-15(14)16(24)6-7-17(24)25)31-23-20(28)18(26)19(27)21(32-23)22(29)30/h3,5,10,14-16,18-21,23,26-28H,2,4,6-9H2,1H3,(H,29,30)/p-1/t14-,15-,16+,18+,19+,20-,21+,23-,24+/m1/s1 |
| InChIKey | FJAZVHYPASAQKM-JBAURARKSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| estrone 3-O-(β-D-glucuronide)(1−) (CHEBI:136634) is a estrane conjugate (CHEBI:167107) |
| estrone 3-O-(β-D-glucuronide)(1−) (CHEBI:136634) is a steroid glucosiduronic acid anion (CHEBI:136637) |
| estrone 3-O-(β-D-glucuronide)(1−) (CHEBI:136634) is a β-D-glucosiduronate (CHEBI:83411) |
| estrone 3-O-(β-D-glucuronide)(1−) (CHEBI:136634) is conjugate base of estrone 3-O-(β-D-glucuronide) (CHEBI:28919) |
| Incoming Relation(s) |
| estrone 3-O-(β-D-glucuronide) (CHEBI:28919) is conjugate acid of estrone 3-O-(β-D-glucuronide)(1−) (CHEBI:136634) |
| IUPAC Name |
|---|
| 17-oxoestra-1,3,5(10)-trien-3-yl β-D-glucopyranosiduronate |
| UniProt Name | Source |
|---|---|
| estrone 3-O-(β-D-glucuronate) | UniProt |
| Citations |
|---|