EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O4 |
| Net Charge | 0 |
| Average Mass | 338.488 |
| Monoisotopic Mass | 338.24571 |
| SMILES | CCCCC/C=C\C/C=C\C(/C=C\CCCCCCC(=O)O)OO |
| InChI | InChI=1S/C20H34O4/c1-2-3-4-5-6-7-10-13-16-19(24-23)17-14-11-8-9-12-15-18-20(21)22/h6-7,13-14,16-17,19,23H,2-5,8-12,15,18H2,1H3,(H,21,22)/b7-6-,16-13-,17-14- |
| InChIKey | PLVFLCHPIRQAAD-NOWHTQDTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (8Z,11Z,14Z)-10-hydroperoxyicosatrienoic acid (CHEBI:136630) has functional parent all-cis-icosa-8,11,14-trienoic acid (CHEBI:53486) |
| (8Z,11Z,14Z)-10-hydroperoxyicosatrienoic acid (CHEBI:136630) is a hydroperoxyicosatrienoic acid (CHEBI:136627) |
| (8Z,11Z,14Z)-10-hydroperoxyicosatrienoic acid (CHEBI:136630) is conjugate acid of (8Z,11Z,14Z)-10-hydroperoxyicosatrienoate (CHEBI:134052) |
| Incoming Relation(s) |
| (8Z,11Z,14Z)-10-hydroperoxyicosatrienoate (CHEBI:134052) is conjugate base of (8Z,11Z,14Z)-10-hydroperoxyicosatrienoic acid (CHEBI:136630) |
| IUPAC Name |
|---|
| (8Z,11Z,14Z)-10-hydroperoxyicosa-8,11,14-trienoic acid |
| Synonyms | Source |
|---|---|
| 10-HPETrE | ChEBI |
| 10-hydroperoxy-(8Z,11Z,14Z)-eicosatrienoic acid | ChEBI |
| 10-hydroperoxy-(8Z,11Z,14Z)-icosatrienoic acid | ChEBI |