EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H39NO3 |
| Net Charge | 0 |
| Average Mass | 341.536 |
| Monoisotopic Mass | 341.29299 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C20H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)21-18-20(23)24/h2-18H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | UEYROBDNFIWNST-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | - | PubMed (20305126) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-octadecanoylglycine (CHEBI:136623) has functional parent octadecanoic acid (CHEBI:28842) |
| N-octadecanoylglycine (CHEBI:136623) has role human metabolite (CHEBI:77746) |
| N-octadecanoylglycine (CHEBI:136623) is a N-acylglycine 18:0 (CHEBI:134151) |
| N-octadecanoylglycine (CHEBI:136623) is a fatty amide (CHEBI:29348) |
| N-octadecanoylglycine (CHEBI:136623) is conjugate acid of N-octadecanoylglycinate (CHEBI:134041) |
| Incoming Relation(s) |
| N-octadecanoylglycinate (CHEBI:134041) is conjugate base of N-octadecanoylglycine (CHEBI:136623) |
| IUPAC Name |
|---|
| N-octadecanoylglycine |
| Synonyms | Source |
|---|---|
| octadecanoylglycine | ChEBI |
| (octadecanoylamino)acetic acid | IUPAC |
| N-stearoylglycine | ChEBI |
| stearoylglycine | ChEBI |
| N-stearoyl glycine | LIPID MAPS |
| N-octadecanoyl-glycine | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA08020077 | LIPID MAPS |
| HMDB0013308 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1801426 | Reaxys |
| CAS:6333-54-6 | ChemIDplus |
| Citations |
|---|