EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H33NO3 |
| Net Charge | 0 |
| Average Mass | 311.466 |
| Monoisotopic Mass | 311.24604 |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C18H33NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17(20)19-16-18(21)22/h7-8H,2-6,9-16H2,1H3,(H,19,20)(H,21,22)/b8-7- |
| InChIKey | YWPIANMBCWTPEE-FPLPWBNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | - | PubMed (20305126) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(9Z)-hexadecenoyl]glycine (CHEBI:136618) has functional parent palmitoleic acid (CHEBI:28716) |
| N-[(9Z)-hexadecenoyl]glycine (CHEBI:136618) has role human metabolite (CHEBI:77746) |
| N-[(9Z)-hexadecenoyl]glycine (CHEBI:136618) is a N-acylglycine 16:1 (CHEBI:134150) |
| N-[(9Z)-hexadecenoyl]glycine (CHEBI:136618) is a fatty amide (CHEBI:29348) |
| N-[(9Z)-hexadecenoyl]glycine (CHEBI:136618) is conjugate acid of N-[(9Z)-hexadecenoyl]glycinate (CHEBI:134042) |
| Incoming Relation(s) |
| N-[(9Z)-hexadecenoyl]glycinate (CHEBI:134042) is conjugate base of N-[(9Z)-hexadecenoyl]glycine (CHEBI:136618) |
| IUPAC Name |
|---|
| N-[(9Z)-hexadec-9-enoyl]glycine |
| Synonyms | Source |
|---|---|
| {[(9Z)-hexadec-9-enoyl]amino}acetic acid | IUPAC |
| (9Z)-hexadecenoylglycine | ChEBI |
| N-(9Z-hexadecenoyl)glycine | ChEBI |
| N-palmitoleoylglycine | ChEBI |
| palmitoleoylglycine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27471066 | Reaxys |
| Citations |
|---|