EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H39NO4 |
| Net Charge | 0 |
| Average Mass | 369.546 |
| Monoisotopic Mass | 369.28791 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C21H39NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(24)22-19(18-23)21(25)26/h9-10,19,23H,2-8,11-18H2,1H3,(H,22,24)(H,25,26)/b10-9-/t19-/m0/s1 |
| InChIKey | MBDKGXAMSZIDKF-VJIACCKLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (20876113) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Application: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-oleoyl-L-serine (CHEBI:136614) has functional parent oleic acid (CHEBI:16196) |
| N-oleoyl-L-serine (CHEBI:136614) has role bone density conservation agent (CHEBI:50646) |
| N-oleoyl-L-serine (CHEBI:136614) has role mouse metabolite (CHEBI:75771) |
| N-oleoyl-L-serine (CHEBI:136614) is a N-(fatty acyl)-L-α-amino acid (CHEBI:137550) |
| N-oleoyl-L-serine (CHEBI:136614) is a L-serine derivative (CHEBI:84135) |
| N-oleoyl-L-serine (CHEBI:136614) is conjugate acid of N-oleoyl-L-serinate (CHEBI:134031) |
| Incoming Relation(s) |
| N-oleoyl-L-serinate (CHEBI:134031) is conjugate base of N-oleoyl-L-serine (CHEBI:136614) |
| IUPAC Name |
|---|
| N-[(9Z)-octadec-9-enoyl]-L-serine |
| Synonyms | Source |
|---|---|
| (2S)-3-hydroxy-2-{[(9R)-octadec-9-enoyl]amino}propanoic acid | IUPAC |
| N-[(9Z)-octadecenoyl]serine | ChEBI |
| N-(9Z-octadecenoyl)-L-serine | ChEBI |
| N-[(9Z)-octadecenoyl]-L-serine | ChEBI |
| N-oleoylserine | ChEBI |
| oleoylserine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14193105 | Reaxys |
| Citations |
|---|