EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O14 |
| Net Charge | 0 |
| Average Mass | 610.524 |
| Monoisotopic Mass | 610.13226 |
| SMILES | [H][C@]1(c2cc(O)c(O)c(O)c2-c2c([C@@]3([H])Oc4cc(O)cc(O)c4C[C@H]3O)cc(O)c(O)c2O)Oc2cc(O)cc(O)c2C[C@H]1O |
| InChI | InChI=1S/C30H26O14/c31-9-1-15(33)11-5-19(37)29(43-21(11)3-9)13-7-17(35)25(39)27(41)23(13)24-14(8-18(36)26(40)28(24)42)30-20(38)6-12-16(34)2-10(32)4-22(12)44-30/h1-4,7-8,19-20,29-42H,5-6H2/t19-,20-,29-,30-/m1/s1 |
| InChIKey | JPBGHWKYWUEIOT-XYTTVBAYSA-N |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Theasinensin C (CHEBI:136611) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 6,6'-Bis[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]-2,2',3,3',4,4'-biphenylhexol |
| Manual Xrefs | Databases |
|---|---|
| 410678 | ChemSpider |
| HMDB0038829 | HMDB |