EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H24O12 |
| Net Charge | 0 |
| Average Mass | 564.499 |
| Monoisotopic Mass | 564.12678 |
| SMILES | [H][C@]1(c2cc(=O)c(O)c3c(O)c(O)cc([C@@]4([H])Oc5cc(O)cc(O)c5C[C@H]4O)c3c2)Oc2cc(O)cc(O)c2C[C@H]1O |
| InChI | InChI=1S/C29H24O12/c30-11-3-17(32)15-8-21(36)28(40-23(15)5-11)10-1-13-14(7-20(35)27(39)25(13)26(38)19(34)2-10)29-22(37)9-16-18(33)4-12(31)6-24(16)41-29/h1-7,21-22,28-33,35-37,39H,8-9H2,(H,34,38)/t21-,22-,28-,29-/m1/s1 |
| InChIKey | IPMYMEWFZKHGAX-ZKSIBHASSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis (ncbitaxon:4442) | leaf (BTO:0000713) | Article (Tetrahedron, 1973, v29, 125) |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | radiation protective agent Any compound that is able to protect normal cells from the damage caused by radiation therapy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| theaflavin (CHEBI:136609) has role antibacterial agent (CHEBI:33282) |
| theaflavin (CHEBI:136609) has role antioxidant (CHEBI:22586) |
| theaflavin (CHEBI:136609) has role chelator (CHEBI:38161) |
| theaflavin (CHEBI:136609) has role plant metabolite (CHEBI:76924) |
| theaflavin (CHEBI:136609) has role radiation protective agent (CHEBI:66987) |
| theaflavin (CHEBI:136609) is a biflavonoid (CHEBI:50128) |
| theaflavin (CHEBI:136609) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 3,4,5-trihydroxy-1,8-bis[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]-6H-benzocyclohepten-6-one |
| Synonyms | Source |
|---|---|
| 1,8-bis((2R,3R)-3,5,7-trihydroxy-2H-1-benzopyran-2-yl)-3,4,6-trihydroxy-5H-benzocyclohepten-5-one | ChemIDplus |
| 1,8-bis(3-α,5,7-trihydroxy-2-α-chromanyl)-5H-benzocyclohepten-5-one | ChemIDplus |
| 3,4,5-trihydroxy-1,8-bis[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-2-yl]-6H-benzo[7]annulen-6-one | IUPAC |
| (−)-theaflavin | ChEBI |
| theaflavine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 102754 | ChemSpider |
| C00009348 | KNApSAcK |
| FDB012511 | FooDB |
| HMDB0005788 | HMDB |
| KR20080052675 | Patent |
| Theaflavin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:25497520 | Reaxys |
| CAS:4670-05-7 | ChemIDplus |
| Citations |
|---|