EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H41NO3 |
| Net Charge | 0 |
| Average Mass | 451.651 |
| Monoisotopic Mass | 451.30864 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C29H41NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-24-28(31)30-27(29(32)33)25-26-22-19-18-20-23-26/h6-7,9-10,12-13,15-16,18-20,22-23,27H,2-5,8,11,14,17,21,24-25H2,1H3,(H,30,31)(H,32,33)/b7-6-,10-9-,13-12-,16-15-/t27-/m0/s1 |
| InChIKey | YHLNAFGXMQKMQX-CYPURTGSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-arachidonoyl-L-phenylalanine (CHEBI:136606) has functional parent arachidonic acid (CHEBI:15843) |
| N-arachidonoyl-L-phenylalanine (CHEBI:136606) is a N-acyl-L-phenylalanine (CHEBI:77673) |
| N-arachidonoyl-L-phenylalanine (CHEBI:136606) is a fatty amide (CHEBI:29348) |
| N-arachidonoyl-L-phenylalanine (CHEBI:136606) is conjugate acid of N-arachidonoyl-L-phenylalaninate (CHEBI:134022) |
| Incoming Relation(s) |
| N-arachidonoyl-L-phenylalaninate (CHEBI:134022) is conjugate base of N-arachidonoyl-L-phenylalanine (CHEBI:136606) |
| IUPAC Name |
|---|
| N-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]-L-phenylalanine |
| Synonyms | Source |
|---|---|
| arachidonoylphenylalanine | ChEBI |
| N-arachidonoylphenylalanine | ChEBI |
| N-(5Z,8Z,11Z,14Z-icosatetraenoyl)-L-phenylalanine | ChEBI |
| (2S)-2-{[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino}-3-phenylpropanoic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11148960 | Reaxys |