EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23O5S |
| Net Charge | -1 |
| Average Mass | 351.444 |
| Monoisotopic Mass | 351.12717 |
| SMILES | [H][C@@]12CCc3cc(OS(=O)(=O)[O-])ccc3[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C18H24O5S/c1-18-9-8-14-13-5-3-12(23-24(20,21)22)10-11(13)2-4-15(14)16(18)6-7-17(18)19/h3,5,10,14-17,19H,2,4,6-9H2,1H3,(H,20,21,22)/p-1/t14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | QZIGLSSUDXBTLJ-ZBRFXRBCSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17β-estradiol 3-sulfate(1−) (CHEBI:136582) is a estrane conjugate (CHEBI:167107) |
| 17β-estradiol 3-sulfate(1−) (CHEBI:136582) is a steroid sulfate oxoanion (CHEBI:59696) |
| 17β-estradiol 3-sulfate(1−) (CHEBI:136582) is conjugate base of 17β-estradiol 3-sulfate (CHEBI:4866) |
| Incoming Relation(s) |
| 17β-estradiol 3-sulfate (CHEBI:4866) is conjugate acid of 17β-estradiol 3-sulfate(1−) (CHEBI:136582) |
| IUPAC Name |
|---|
| 17β-hydroxyestra-1(10),2,4-trien-3-yl sulfate |
| Synonym | Source |
|---|---|
| (17β)-17-hydroxyestra-1(10),2,4-trien-3-yl sulfate | ChEBI |
| UniProt Name | Source |
|---|---|
| 17β-estradiol 3-sulfate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3705507 | Reaxys |
| Citations |
|---|