EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO7 |
| Net Charge | 0 |
| Average Mass | 327.333 |
| Monoisotopic Mass | 327.13180 |
| SMILES | O=C(O)[C@H](Cc1ccccc1)NCC1(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H21NO7/c17-7-11-12(18)13(19)15(22,23-11)8-16-10(14(20)21)6-9-4-2-1-3-5-9/h1-5,10-13,16-19,22H,6-8H2,(H,20,21)/t10-,11+,12+,13-,15?/m0/s1 |
| InChIKey | FAVRCIXPIVJIPN-VJDSNFAGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis (ncbitaxon:4442) | - | MetaboLights (MTBLS403) |
| Roles Classification |
|---|
| Biological Role: | Camellia sinensis metabolite Any plant metabolite that is produced by Camellia sinensis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(1-deoxy-1-fructosyl)phenylalanine (CHEBI:136561) has functional parent D-fructofuranose (CHEBI:37721) |
| N-(1-deoxy-1-fructosyl)phenylalanine (CHEBI:136561) has role Camellia sinensis metabolite (CHEBI:140160) |
| N-(1-deoxy-1-fructosyl)phenylalanine (CHEBI:136561) is a L-phenylalanine derivative (CHEBI:84144) |
| N-(1-deoxy-1-fructosyl)phenylalanine (CHEBI:136561) is a monosaccharide derivative (CHEBI:63367) |
| Synonyms | Source |
|---|---|
| (2S)-3-phenyl-2-({[(3S,4S,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl}amino)propanoic acid | IUPAC |
| N-(D-fructos-1-yl)phenylalanine | ChEBI |
| N-(1-deoxy-1-fructosyl)-L-phenylalanine | ChEBI |
| N-(D-fructos-1-yl)-L-phenylalanine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0037846 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8348487 | Reaxys |