EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36O11 |
| Net Charge | 0 |
| Average Mass | 464.508 |
| Monoisotopic Mass | 464.22576 |
| SMILES | C=CC1(C)CCC(C(C)(C)OC2O[C@H](CO[C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O1 |
| InChI | InChI=1S/C21H36O11/c1-5-21(4)7-6-12(31-21)20(2,3)32-19-17(27)15(25)14(24)11(30-19)9-29-18-16(26)13(23)10(22)8-28-18/h5,10-19,22-27H,1,6-9H2,2-4H3/t10-,11-,12?,13+,14-,15+,16-,17-,18+,19?,21?/m1/s1 |
| InChIKey | CXCRZTANOZWBHN-FFHQWLQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis (ncbitaxon:4442) | - | MetaboLights (MTBLS403) |
| Roles Classification |
|---|
| Biological Role: | Camellia sinensis metabolite Any plant metabolite that is produced by Camellia sinensis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| linalool 3,6-oxide primeveroside (CHEBI:136549) has role Camellia sinensis metabolite (CHEBI:140160) |
| linalool 3,6-oxide primeveroside (CHEBI:136549) is a disaccharide derivative (CHEBI:63353) |
| linalool 3,6-oxide primeveroside (CHEBI:136549) is a glycoside (CHEBI:24400) |
| linalool 3,6-oxide primeveroside (CHEBI:136549) is a oxolanes (CHEBI:26912) |
| IUPAC Names |
|---|
| 2-(5-ethenyl-5-methyloxolan-2-yl)propan-2-yl 6-O-β-D-xylopyranosyl-D-glucopyranoside |
| 2-(5-ethenyl-5-methyloxolan-2-yl)propan-2-yl β-D-xylopyranosyl-(1→6)-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| linalool 3,6-oxide 6-xylopyranosylglucopyranoside | ChEBI |