EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:136532 - 8-azahypoxanthine
| Formula | C4H3N5O |
| Net Charge | 0 |
| Average Mass | 137.102 |
| Monoisotopic Mass | 137.03376 |
| SMILES | O=c1ncnc2nnnc12 |
| InChI | InChI=1S/C4H3N5O/c10-4-2-3(5-1-6-4)8-9-7-2/h1H,(H2,5,6,7,8,9,10) |
| InChIKey | OEEYCNOOAHGFHL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.4.2.8 (hypoxanthine phosphoribosyltransferase) inhibitor An EC 2.4.2.* (pentosyltransferase) inhibitor that interferes with the action of hypoxanthine phosphoribosyltransferase (EC 2.4.2.8). antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-azahypoxanthine (CHEBI:136532) has role antimalarial (CHEBI:38068) |
| 8-azahypoxanthine (CHEBI:136532) has role EC 2.4.2.8 (hypoxanthine phosphoribosyltransferase) inhibitor (CHEBI:136537) |
| 8-azahypoxanthine (CHEBI:136532) is a nucleobase analogue (CHEBI:67142) |
| 8-azahypoxanthine (CHEBI:136532) is a triazolopyrimidines (CHEBI:48435) |
| IUPAC Name |
|---|
| 1,4-dihydro-7H-[1,2,3]triazolo[4,5-d]pyrimidin-7-one |
| Synonyms | Source |
|---|---|
| 1H-1,2,3-triazolo(4,5-d)pyrimidin-7-ol | ChemIDplus |
| 7-hydroxy-1,2,3,4,6-pentaazaindene | ChemIDplus |
| 8-azaHx | ChEBI |
| azahypoxanthine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:513873 | Reaxys |
| CAS:2683-90-1 | ChemIDplus |
| Citations |
|---|