EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H3N5O |
| Net Charge | 0 |
| Average Mass | 137.102 |
| Monoisotopic Mass | 137.03376 |
| SMILES | O=c1ncnc2nnnc12 |
| InChI | InChI=1S/C4H3N5O/c10-4-2-3(5-1-6-4)8-9-7-2/h1H,(H2,5,6,7,8,9,10) |
| InChIKey | OEEYCNOOAHGFHL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. EC 2.4.2.8 (hypoxanthine phosphoribosyltransferase) inhibitor An EC 2.4.2.* (pentosyltransferase) inhibitor that interferes with the action of hypoxanthine phosphoribosyltransferase (EC 2.4.2.8). |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-azahypoxanthine (CHEBI:136532) has role antimalarial (CHEBI:38068) |
| 8-azahypoxanthine (CHEBI:136532) has role EC 2.4.2.8 (hypoxanthine phosphoribosyltransferase) inhibitor (CHEBI:136537) |
| 8-azahypoxanthine (CHEBI:136532) is a nucleobase analogue (CHEBI:67142) |
| 8-azahypoxanthine (CHEBI:136532) is a triazolopyrimidines (CHEBI:48435) |
| IUPAC Name |
|---|
| 1,4-dihydro-7H-[1,2,3]triazolo[4,5-d]pyrimidin-7-one |
| Synonyms | Source |
|---|---|
| 1H-1,2,3-triazolo(4,5-d)pyrimidin-7-ol | ChemIDplus |
| 7-hydroxy-1,2,3,4,6-pentaazaindene | ChemIDplus |
| 8-azaHx | ChEBI |
| azahypoxanthine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:513873 | Reaxys |
| CAS:2683-90-1 | ChemIDplus |
| Citations |
|---|