EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | CCCCC[C@H](O)[C@H](O)/C=C/C=C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O4/c1-2-3-12-15-18(21)19(22)16-13-10-8-6-4-5-7-9-11-14-17-20(23)24/h4,6-10,13,16,18-19,21-22H,2-3,5,11-12,14-15,17H2,1H3,(H,23,24)/b6-4-,9-7-,10-8+,16-13+/t18-,19+/m0/s1 |
| InChIKey | RFCYXKNVYQOCTM-PEPUZGFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | - | PubMed (8334154) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14(R),15(S)-DiHETE (CHEBI:136500) has role human xenobiotic metabolite (CHEBI:76967) |
| 14(R),15(S)-DiHETE (CHEBI:136500) is a dihydroxyicosatetraenoic acid (CHEBI:72868) |
| 14(R),15(S)-DiHETE (CHEBI:136500) is conjugate acid of 14(R),15(S)-DiHETE(1−) (CHEBI:133916) |
| Incoming Relation(s) |
| 14(R),15(S)-DiHETE(1−) (CHEBI:133916) is conjugate base of 14(R),15(S)-DiHETE (CHEBI:136500) |
| IUPAC Name |
|---|
| (5Z,8Z,10E,12E,14R,15S)-14,15-dihydroxyicosa-5,8,10,12-tetraenoic acid |
| Synonyms | Source |
|---|---|
| (14R,15S)-DiHETE | ChEBI |
| (14R,15S)-dihydroxy-(5Z,8Z,10E,12E)-eicosatetraenoic acid | ChEBI |
| (14R,15S)-dihydroxy-(5Z,8Z,10E,12E)-icosatetraenoic acid | ChEBI |
| (5Z,8Z,10E,12E,14R,15S)-14,15-dihydroxyeicosatetraenoic acid | ChEBI |
| (5Z,8Z,10E,12E,14R,15S)-14,15-dihydroxyicosatetraenoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4704842 | Reaxys |
| Citations |
|---|