EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16ClNO |
| Net Charge | 0 |
| Average Mass | 225.719 |
| Monoisotopic Mass | 225.09204 |
| SMILES | CCc1cccc(CC)c1NC(=O)CCl |
| InChI | InChI=1S/C12H16ClNO/c1-3-9-6-5-7-10(4-2)12(9)14-11(15)8-13/h5-7H,3-4,8H2,1-2H3,(H,14,15) |
| InChIKey | LBJVHMAYBNQJBK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus sp. HYS-1 (ncbitaxon:1622086) | - | PubMed (26368393) | |
| Cunninghamella elegans (ncbitaxon:4853) | - | DOI (10.1021/jf00027a026) | Strain: ATCC 36112 |
| Homo Sapiens (ncbitaxon:9606) | - | PubMed (10475613) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (11133395) |
| Roles Classification |
|---|
| Biological Roles: | fungal xenobiotic metabolite Any fungal metabolite produced by metabolism of a xenobiotic compound in fungi. bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(2,6-diethylphenyl)-2-chloroacetamide (CHEBI:136492) has functional parent chloroacetic acid (CHEBI:27869) |
| N-(2,6-diethylphenyl)-2-chloroacetamide (CHEBI:136492) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| N-(2,6-diethylphenyl)-2-chloroacetamide (CHEBI:136492) has role carcinogenic agent (CHEBI:50903) |
| N-(2,6-diethylphenyl)-2-chloroacetamide (CHEBI:136492) has role fungal xenobiotic metabolite (CHEBI:76968) |
| N-(2,6-diethylphenyl)-2-chloroacetamide (CHEBI:136492) has role genotoxin (CHEBI:50902) |
| N-(2,6-diethylphenyl)-2-chloroacetamide (CHEBI:136492) has role human xenobiotic metabolite (CHEBI:76967) |
| N-(2,6-diethylphenyl)-2-chloroacetamide (CHEBI:136492) has role rat metabolite (CHEBI:86264) |
| N-(2,6-diethylphenyl)-2-chloroacetamide (CHEBI:136492) is a aromatic amide (CHEBI:62733) |
| N-(2,6-diethylphenyl)-2-chloroacetamide (CHEBI:136492) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 2-chloro-N-(2,6-diethylphenyl)acetamide |
| Synonyms | Source |
|---|---|
| 2-Chloro-2',6'-diethylacetanilide | ChemIDplus |
| N-2'-Chloroacetyl-2,6-diethylaniline | NIST Chemistry WebBook |
| α-chloro-2',6'-diethylacetanilide | ChEBI |
| UniProt Name | Source |
|---|---|
| N-(2,6-diethylphenyl)-2-chloroacetamide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-18945 | MetaCyc |
| HMDB0032855 | HMDB |
| Citations |
|---|