EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H31NO9 |
| Net Charge | 0 |
| Average Mass | 441.477 |
| Monoisotopic Mass | 441.19988 |
| SMILES | CC(=O)O[C@@]1(C)C(=O)OC/C2=C/CN(C)CC[C@@H](OC(=O)[C@@](O)([C@@H](C)O)C[C@H]1C)C2=O |
| InChI | InChI=1S/C21H31NO9/c1-12-10-21(28,13(2)23)19(27)30-16-7-9-22(5)8-6-15(17(16)25)11-29-18(26)20(12,4)31-14(3)24/h6,12-13,16,23,28H,7-11H2,1-5H3/b15-6-/t12-,13-,16-,20-,21+/m1/s1 |
| InChIKey | MPJBVZKNLCGQHF-XAHVSKGQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jacobaea (ncbitaxon:405757) | |||
| leaf (BTO:0000713) | DOI (10.1007/s11306-017-1184-0) | ||
| leaf (BTO:0000713) | MetaboLights (MTBLS429) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Jacobaea metabolite Any plant metabolite that is produced by the genus Jacobaea. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| floridanine (CHEBI:136491) has functional parent onetine (CHEBI:136473) |
| floridanine (CHEBI:136491) has role Jacobaea metabolite (CHEBI:139566) |
| floridanine (CHEBI:136491) is a acetate ester (CHEBI:47622) |
| floridanine (CHEBI:136491) is a diol (CHEBI:23824) |
| floridanine (CHEBI:136491) is a enone (CHEBI:51689) |
| floridanine (CHEBI:136491) is a macrocyclic lactone (CHEBI:63944) |
| floridanine (CHEBI:136491) is a organic heterobicyclic compound (CHEBI:27171) |
| floridanine (CHEBI:136491) is a pyrrolizine alkaloid (CHEBI:38521) |
| floridanine (CHEBI:136491) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Names |
|---|
| (1R,6R,7R,11Z)-4-Hydroxy-4-(1-hydroxyethyl)-6,7,14-trimethyl-3,8,17-trioxo-2,9-dioxa-14-azabicyclo[9.5.1]heptadec-11-en-7-yl acetate |
| (1R,4S,6R,7R,11Z)-4-hydroxy-4-[(1R)-1-hydroxyethyl]-6,7,14-trimethyl-3,8,17-trioxo-2,9-dioxa-14-azabicyclo[9.5.1]heptadec-11-en-7-yl acetate |
| Synonym | Source |
|---|---|
| Floradanin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4945572 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1095921 | Beilstein |
| Reaxys:23831190 | Reaxys |
| CAS:16958-31-9 | ChemIDplus |
| Citations |
|---|