EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28ClNO7 |
| Net Charge | 0 |
| Average Mass | 417.886 |
| Monoisotopic Mass | 417.15543 |
| SMILES | C[C@@H]1C[C@](O)([C@@H](C)Cl)C(=O)O[C@@H]2CCN(C)C/C=C(/COC(=O)[C@]1(C)O)C2=O |
| InChI | InChI=1S/C19H28ClNO7/c1-11-9-19(26,12(2)20)17(24)28-14-6-8-21(4)7-5-13(15(14)22)10-27-16(23)18(11,3)25/h5,11-12,14,25-26H,6-10H2,1-4H3/b13-5-/t11-,12-,14-,18-,19+/m1/s1 |
| InChIKey | OMHSMPLRLNEBIB-NMUBGGKPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Emilia sonchifolia (ncbitaxon:415160) | - | DOI (10.1016/j.jfca.2015.01.020) | |
| Jacobaea (ncbitaxon:405757) | |||
| leaf (BTO:0000713) | DOI (10.1007/s11306-017-1184-0) | ||
| leaf (BTO:0000713) | MetaboLights (MTBLS429) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Jacobaea metabolite Any plant metabolite that is produced by the genus Jacobaea. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desacetyldoronine (CHEBI:136487) has role Jacobaea metabolite (CHEBI:139566) |
| desacetyldoronine (CHEBI:136487) is a diol (CHEBI:23824) |
| desacetyldoronine (CHEBI:136487) is a enone (CHEBI:51689) |
| desacetyldoronine (CHEBI:136487) is a macrocyclic lactone (CHEBI:63944) |
| desacetyldoronine (CHEBI:136487) is a organic heterobicyclic compound (CHEBI:27171) |
| desacetyldoronine (CHEBI:136487) is a organochlorine compound (CHEBI:36683) |
| desacetyldoronine (CHEBI:136487) is a pyrrolizine alkaloid (CHEBI:38521) |
| desacetyldoronine (CHEBI:136487) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (1R,4R,6R,7R,11Z)-4-[(1R)-1-chloroethyl]-4,7-dihydroxy-6,7,14-trimethyl-2,9-dioxa-14-azabicyclo[9.5.1]heptadec-11-ene-3,8,17-trione |
| Manual Xrefs | Databases |
|---|---|
| 4946514 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:120481-77-8 | ChemIDplus |
| Citations |
|---|