EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25NO7 |
| Net Charge | 0 |
| Average Mass | 367.398 |
| Monoisotopic Mass | 367.16310 |
| SMILES | [H][C@]12C3=CC[N+]1([O-])CC[C@H]2OC(=O)[C@@]1(C[C@@H](C)[C@@](C)(O)C(=O)OC3)O[C@H]1C |
| InChI | InChI=1S/C18H25NO7/c1-10-8-18(11(2)26-18)16(21)25-13-5-7-19(23)6-4-12(14(13)19)9-24-15(20)17(10,3)22/h4,10-11,13-14,22H,5-9H2,1-3H3/t10-,11+,13-,14-,17-,18+,19?/m1/s1 |
| InChIKey | NKRQJWQYBNTAEV-SAJQNFQWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Jacobaea (ncbitaxon:405757) | |||
| leaf (BTO:0000713) | MetaboLights (MTBLS429) | ||
| leaf (BTO:0000713) | DOI (10.1007/s11306-017-1184-0) |
| Roles Classification |
|---|
| Biological Roles: | Jacobaea metabolite Any plant metabolite that is produced by the genus Jacobaea. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jacobine N-oxide (CHEBI:136451) has functional parent jacobine (CHEBI:6080) |
| jacobine N-oxide (CHEBI:136451) has role Jacobaea metabolite (CHEBI:139566) |
| jacobine N-oxide (CHEBI:136451) has role insecticide (CHEBI:24852) |
| jacobine N-oxide (CHEBI:136451) is a macrocyclic lactone (CHEBI:63944) |
| jacobine N-oxide (CHEBI:136451) is a organic heterotricyclic compound (CHEBI:26979) |
| jacobine N-oxide (CHEBI:136451) is a pyrrolizine alkaloid (CHEBI:38521) |
| jacobine N-oxide (CHEBI:136451) is a spiro-epoxide (CHEBI:133131) |
| jacobine N-oxide (CHEBI:136451) is a tertiary alcohol (CHEBI:26878) |
| jacobine N-oxide (CHEBI:136451) is a tertiary amine oxide (CHEBI:134363) |
| IUPAC Name |
|---|
| (3S,3'S,5R,6R,14aR,14bR)-6-hydroxy-3',5,6-trimethyl-12-oxo-5,6,11,12,13,14,14a,14b-octahydro-2H,9H-spiro[1,6-dioxacyclododecino[2,3,4-gh]pyrrolizine-3,2'-oxirane]-2,7(4H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20340584 | Reaxys |
| Citations |
|---|