EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18N4O4 |
| Net Charge | 0 |
| Average Mass | 402.410 |
| Monoisotopic Mass | 402.13281 |
| SMILES | N=C(C(=O)O)C(c1cnc2ccccc12)C(C(=N)C(=O)O)c1cnc2ccccc12 |
| InChI | InChI=1S/C22H18N4O4/c23-19(21(27)28)17(13-9-25-15-7-3-1-5-11(13)15)18(20(24)22(29)30)14-10-26-16-8-4-2-6-12(14)16/h1-10,17-18,23-26H,(H,27,28)(H,29,30) |
| InChIKey | CKBGWXPNAUCVQQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chromobacterium violaceum (ncbitaxon:536) | - | PubMed (17176066) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-diimino-3,4-bis(indol-3-yl)hexanedioic acid (CHEBI:136433) has functional parent 2-imino-3-(indol-3-yl)propanoic acid (CHEBI:90891) |
| 2,5-diimino-3,4-bis(indol-3-yl)hexanedioic acid (CHEBI:136433) has role bacterial metabolite (CHEBI:76969) |
| 2,5-diimino-3,4-bis(indol-3-yl)hexanedioic acid (CHEBI:136433) is a dicarboxylic acid (CHEBI:35692) |
| 2,5-diimino-3,4-bis(indol-3-yl)hexanedioic acid (CHEBI:136433) is a indoles (CHEBI:24828) |
| 2,5-diimino-3,4-bis(indol-3-yl)hexanedioic acid (CHEBI:136433) is a ketimine (CHEBI:33272) |
| 2,5-diimino-3,4-bis(indol-3-yl)hexanedioic acid (CHEBI:136433) is tautomer of 2,5-diiminio-3,4-bis(indol-3-yl)hexanedioate (CHEBI:133928) |
| Incoming Relation(s) |
| 2,5-diiminio-3,4-bis(indol-3-yl)hexanedioate (CHEBI:133928) is tautomer of 2,5-diimino-3,4-bis(indol-3-yl)hexanedioic acid (CHEBI:136433) |
| IUPAC Name |
|---|
| 2,5-diimino-3,4-di(1H-indol-3-yl)hexanedioic acid |
| Synonym | Source |
|---|---|
| indole-3-pyruvic acid imine dimer | ChEBI |
| Citations |
|---|