EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9N2OS |
| Net Charge | -1 |
| Average Mass | 205.262 |
| Monoisotopic Mass | 205.04411 |
| SMILES | O/N=C(/[S-])Cc1cnc2ccccc12 |
| InChI | InChI=1S/C10H10N2OS/c13-12-10(14)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11,13H,5H2,(H,12,14)/p-1 |
| InChIKey | NPTAQBFHUNRJAR-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-2-(indol-3-yl)-1-thioacetohydroximate (CHEBI:136432) is a organic sulfur anion (CHEBI:84291) |
| (E)-2-(indol-3-yl)-1-thioacetohydroximate (CHEBI:136432) is conjugate base of (E)-2-(indol-3-yl)-1-thioacetohydroximic acid (CHEBI:137211) |
| Incoming Relation(s) |
| (E)-2-(indol-3-yl)-1-thioacetohydroximic acid (CHEBI:137211) is conjugate acid of (E)-2-(indol-3-yl)-1-thioacetohydroximate (CHEBI:136432) |
| IUPAC Name |
|---|
| (1E)-2-(1H-indol-3-yl)ethanehydroximothioate |
| Synonym | Source |
|---|---|
| indolylmethylthiohydroximate | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-1861 | MetaCyc |