EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25NO7 |
| Net Charge | 0 |
| Average Mass | 367.398 |
| Monoisotopic Mass | 367.16310 |
| SMILES | [H][C@]12C3=CC[N+]1([O-])CC[C@H]2OC(=O)/C(=C/C)C[C@@H](C)[C@](O)(CO)C(=O)OC3 |
| InChI | InChI=1S/C18H25NO7/c1-3-12-8-11(2)18(23,10-20)17(22)25-9-13-4-6-19(24)7-5-14(15(13)19)26-16(12)21/h3-4,11,14-15,20,23H,5-10H2,1-2H3/b12-3+/t11-,14-,15-,18-,19?/m1/s1 |
| InChIKey | IDIMIWQPUHURPV-BEPQMMTDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crotalaria pallida (ncbitaxon:3830) | - | PubMed (28777979) | |
| Jacobaea (ncbitaxon:405757) | |||
| leaf (BTO:0000713) | DOI (10.1007/s11306-017-1184-0) | ||
| leaf (BTO:0000713) | MetaboLights (MTBLS429) | ||
| Senecio vulgaris (ncbitaxon:76276) | - | PubMed (28828276) |
| Roles Classification |
|---|
| Biological Roles: | Jacobaea metabolite Any plant metabolite that is produced by the genus Jacobaea. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| usaramine N-oxide (CHEBI:136429) has functional parent usaramine (CHEBI:9912) |
| usaramine N-oxide (CHEBI:136429) has role Jacobaea metabolite (CHEBI:139566) |
| usaramine N-oxide (CHEBI:136429) is a diol (CHEBI:23824) |
| usaramine N-oxide (CHEBI:136429) is a macrocyclic lactone (CHEBI:63944) |
| usaramine N-oxide (CHEBI:136429) is a olefinic compound (CHEBI:78840) |
| usaramine N-oxide (CHEBI:136429) is a organic heterotricyclic compound (CHEBI:26979) |
| usaramine N-oxide (CHEBI:136429) is a primary alcohol (CHEBI:15734) |
| usaramine N-oxide (CHEBI:136429) is a pyrrolizine alkaloid (CHEBI:38521) |
| usaramine N-oxide (CHEBI:136429) is a tertiary alcohol (CHEBI:26878) |
| usaramine N-oxide (CHEBI:136429) is a tertiary amine oxide (CHEBI:134363) |
| IUPAC Name |
|---|
| (3E,5R,6S,14aR,14bR)-3-ethylidene-6-hydroxy-6-(hydroxymethyl)-5-methyl-12-oxo-3,4,5,6,11,12,13,14,14a,14b-decahydro-9H-12λ5-[1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione |
| Synonyms | Source |
|---|---|
| (15E)-12,18-dihydroxysenecionan-11,16-dione 4-oxide | ChEBI |
| (15E)-12,18-dihydroxysenecionan-11,16-dione N-oxide | ChEBI |
| mucronatine N-oxide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19963004 | Reaxys |
| Citations |
|---|