EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N4O6S2 |
| Net Charge | 0 |
| Average Mass | 470.573 |
| Monoisotopic Mass | 470.12938 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSC(=S)NCCc1ccccc1)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H26N4O6S2/c20-13(18(28)29)6-7-15(24)23-14(17(27)22-10-16(25)26)11-31-19(30)21-9-8-12-4-2-1-3-5-12/h1-5,13-14H,6-11,20H2,(H,21,30)(H,22,27)(H,23,24)(H,25,26)(H,28,29)/t13-,14-/m0/s1 |
| InChIKey | WSGBVCNCZSZCGE-KBPBESRZSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-[(2-phenylethyl)carbamothioyl]glutathione (CHEBI:136426) has functional parent phenethyl isothiocyanate (CHEBI:351346) |
| S-[(2-phenylethyl)carbamothioyl]glutathione (CHEBI:136426) is a dithiocarbamic ester (CHEBI:38129) |
| S-[(2-phenylethyl)carbamothioyl]glutathione (CHEBI:136426) is a glutathione conjugate (CHEBI:24335) |
| S-[(2-phenylethyl)carbamothioyl]glutathione (CHEBI:136426) is conjugate acid of S-[(2-phenylethyl)carbamothioyl]glutathione(1−) (CHEBI:133883) |
| Incoming Relation(s) |
| S-[(2-phenylethyl)carbamothioyl]glutathione(1−) (CHEBI:133883) is conjugate base of S-[(2-phenylethyl)carbamothioyl]glutathione (CHEBI:136426) |
| IUPAC Name |
|---|
| L-γ-glutamyl-S-[(2-phenylethyl)carbamothioyl]-L-cysteinylglycine |
| Synonym | Source |
|---|---|
| S-(N-phenylethylthiocarbamoyl)glutathione | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8398315 | Reaxys |
| Citations |
|---|