EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H47NO4 |
| Net Charge | 0 |
| Average Mass | 425.654 |
| Monoisotopic Mass | 425.35051 |
| SMILES | CCCCCC/C=C/CCCCCCCCCC(=O)O[C@@H](CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C25H47NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25(29)30-23(21-24(27)28)22-26(2,3)4/h10-11,23H,5-9,12-22H2,1-4H3/b11-10+/t23-/m0/s1 |
| InChIKey | HOAMADDCQBUDDY-YSESTWPTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (27635669) | ||
| - | MetaboLights (MTBLS364) |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-[(11E)-octadecenoyl]-D-carnitine (CHEBI:136372) has functional parent trans-vaccenic acid (CHEBI:28727) |
| O-[(11E)-octadecenoyl]-D-carnitine (CHEBI:136372) has role human xenobiotic metabolite (CHEBI:76967) |
| O-[(11E)-octadecenoyl]-D-carnitine (CHEBI:136372) is a O-acyl-D-carnitine (CHEBI:86043) |
| O-[(11E)-octadecenoyl]-D-carnitine (CHEBI:136372) is a O-octadecenoylcarnitine (CHEBI:86475) |
| IUPAC Name |
|---|
| (3S)-3-{[(11E)-octadec-11-enoyl]oxy}-4-(trimethylazaniumyl)butanoate |
| Synonyms | Source |
|---|---|
| O-[(E)-vaccenoyl]-D-carnitine | ChEBI |
| O-(trans-vaccenoyl)-D-carnitine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 30776574 | ChemSpider |
| HMDB0006351 | HMDB |