EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | CCCCC/C=C\C/C=C\CC(=O)/C=C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30O3/c1-2-3-4-5-6-7-8-10-13-16-19(21)17-14-11-9-12-15-18-20(22)23/h6-7,9-11,13-14,17H,2-5,8,12,15-16,18H2,1H3,(H,22,23)/b7-6-,11-9-,13-10-,17-14+ |
| InChIKey | STWROVCBKOAVDG-OIZRIKEUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-oxo-ETE (CHEBI:136365) has functional parent arachidonic acid (CHEBI:15843) |
| 9-oxo-ETE (CHEBI:136365) is a enone (CHEBI:51689) |
| 9-oxo-ETE (CHEBI:136365) is a oxoicosatetraenoic acid (CHEBI:61704) |
| 9-oxo-ETE (CHEBI:136365) is conjugate acid of 9-oxo-ETE(1−) (CHEBI:133851) |
| Incoming Relation(s) |
| 9-oxo-ETE(1−) (CHEBI:133851) is conjugate base of 9-oxo-ETE (CHEBI:136365) |
| IUPAC Name |
|---|
| (5Z,7E,11Z,14Z)-9-oxoicosa-5,7,11,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 9-keto-(5Z,7E,11Z,14Z)-eicosatetraenoic acid | ChEBI |
| 9-oxoETE | ChEBI |
| 9-keto-(5Z,7E,11Z,14Z)-icosatetraenoic acid | ChEBI |
| 9-oxo-(5Z,7E,11Z,14Z)-icosatetraenoic acid | ChEBI |
| 9-oxo-(5Z,7E,11Z,14Z)-eicosatetraenoic acid | ChEBI |
| (5Z,7E,11Z,14Z)-9-oxoicosatetraenoic acid | ChEBI |