EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H51NO6S |
| Net Charge | 0 |
| Average Mass | 541.795 |
| Monoisotopic Mass | 541.34371 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC[C@@H](C)C(=O)NCCS(=O)(=O)O)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C29H51NO6S/c1-18(6-5-7-19(2)27(33)30-14-15-37(34,35)36)22-8-9-23-26-24(11-13-29(22,23)4)28(3)12-10-21(31)16-20(28)17-25(26)32/h18-26,31-32H,5-17H2,1-4H3,(H,30,33)(H,34,35,36)/t18-,19-,20+,21-,22-,23+,24+,25-,26+,28+,29-/m1/s1 |
| InChIKey | JPTLXYYSWLLUOV-KTWWJORASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (27635669) | ||
| - | MetaboLights (MTBLS364) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (25R)-3α,7α-dihydroxy-5β-cholestan-26-oyl taurine (CHEBI:136361) has functional parent (25R)-3α,7α-dihydroxy-5β-cholestan-26-oic acid (CHEBI:48467) |
| (25R)-3α,7α-dihydroxy-5β-cholestan-26-oyl taurine (CHEBI:136361) has functional parent taurine (CHEBI:15891) |
| (25R)-3α,7α-dihydroxy-5β-cholestan-26-oyl taurine (CHEBI:136361) has role human xenobiotic metabolite (CHEBI:76967) |
| (25R)-3α,7α-dihydroxy-5β-cholestan-26-oyl taurine (CHEBI:136361) is a 3α-hydroxy steroid (CHEBI:36835) |
| (25R)-3α,7α-dihydroxy-5β-cholestan-26-oyl taurine (CHEBI:136361) is a 7α-hydroxy steroid (CHEBI:36843) |
| (25R)-3α,7α-dihydroxy-5β-cholestan-26-oyl taurine (CHEBI:136361) is a cholestanoid (CHEBI:50401) |
| (25R)-3α,7α-dihydroxy-5β-cholestan-26-oyl taurine (CHEBI:136361) is a monocarboxylic acid amide (CHEBI:29347) |
| (25R)-3α,7α-dihydroxy-5β-cholestan-26-oyl taurine (CHEBI:136361) is a organosulfonic acid (CHEBI:33551) |
| IUPAC Name |
|---|
| 2-{[(25R)-3α,7α-dihydroxy-26-oxo-5β-cholestan-26-yl]amino}ethane-1-sulfonic acid |
| Synonym | Source |
|---|---|
| 2-{[(3α,5β,7α,25R)-3,7-dihydroxy-26-oxocholestan-26-yl]amino}ethane-1-sulfonic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| LMST05040008 | LIPID MAPS |
| Citations |
|---|