EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | CC[C@@H](O)/C=C/C=C\CC(O)/C=C/C=C/C=C\C(O)CCCC(=O)O |
| InChI | InChI=1S/C20H30O5/c1-2-17(21)11-8-5-9-14-18(22)12-6-3-4-7-13-19(23)15-10-16-20(24)25/h3-9,11-13,17-19,21-23H,2,10,14-16H2,1H3,(H,24,25)/b4-3+,9-5-,11-8+,12-6+,13-7-/t17-,18?,19?/m1/s1 |
| InChIKey | AOPOCGPBAIARAV-OFVAGIAISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Application: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6Z,8E,10E,14Z,16E,18R)-5,12,18-trihydroxyicosapentaenoic acid (CHEBI:136359) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| (6Z,8E,10E,14Z,16E,18R)-5,12,18-trihydroxyicosapentaenoic acid (CHEBI:136359) is a nonclassic icosanoid (CHEBI:61703) |
| (6Z,8E,10E,14Z,16E,18R)-5,12,18-trihydroxyicosapentaenoic acid (CHEBI:136359) is a resolvin (CHEBI:132120) |
| (6Z,8E,10E,14Z,16E,18R)-5,12,18-trihydroxyicosapentaenoic acid (CHEBI:136359) is a triol (CHEBI:27136) |
| (6Z,8E,10E,14Z,16E,18R)-5,12,18-trihydroxyicosapentaenoic acid (CHEBI:136359) is conjugate acid of (6Z,8E,10E,14Z,16E,18R)-5,12,18-trihydroxyicosapentaenoate (CHEBI:133822) |
| Incoming Relation(s) |
| (6Z,8E,10E,14Z,16E,18R)-5,12,18-trihydroxyicosapentaenoate (CHEBI:133822) is conjugate base of (6Z,8E,10E,14Z,16E,18R)-5,12,18-trihydroxyicosapentaenoic acid (CHEBI:136359) |
| IUPAC Name |
|---|
| (6Z,8E,10E,14Z,16E,18R)-5,12,18-trihydroxyicosa-6,8,10,14,16-pentaenoic acid |
| Synonyms | Source |
|---|---|
| (5,12,18R)-trihydroxy-(6Z,8E,10E,14Z,16E)-eicosapentaenoic acid | ChEBI |
| (6Z,8E,10E,14Z,16E,18R)-5,12,18-trihydroxyeicosapentaenoic acid | ChEBI |
| Citations |
|---|