EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | CC/C=C\C[C@@H](O)/C=C/C=C\C=C\C=C\C(O)C(O)CCCC(=O)O |
| InChI | InChI=1S/C20H30O5/c1-2-3-8-12-17(21)13-9-6-4-5-7-10-14-18(22)19(23)15-11-16-20(24)25/h3-10,13-14,17-19,21-23H,2,11-12,15-16H2,1H3,(H,24,25)/b6-4-,7-5+,8-3-,13-9+,14-10+/t17-,18?,19?/m1/s1 |
| InChIKey | ZZMKOZNTEJVKRY-GUBQSTNLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Application: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7E,9E,11Z,13E,15R,17Z)-5,6,15-trihydroxyicosapentaenoic acid (CHEBI:136357) is a hydroxy fatty acid (CHEBI:24654) |
| (7E,9E,11Z,13E,15R,17Z)-5,6,15-trihydroxyicosapentaenoic acid (CHEBI:136357) is a lipoxin (CHEBI:6497) |
| (7E,9E,11Z,13E,15R,17Z)-5,6,15-trihydroxyicosapentaenoic acid (CHEBI:136357) is a long-chain fatty acid (CHEBI:15904) |
| (7E,9E,11Z,13E,15R,17Z)-5,6,15-trihydroxyicosapentaenoic acid (CHEBI:136357) is conjugate acid of (7E,9E,11Z,13E,15R,17Z)-5,6,15-trihydroxyicosapentaenoate (CHEBI:133821) |
| Incoming Relation(s) |
| (7E,9E,11Z,13E,15R,17Z)-5,6,15-trihydroxyicosapentaenoate (CHEBI:133821) is conjugate base of (7E,9E,11Z,13E,15R,17Z)-5,6,15-trihydroxyicosapentaenoic acid (CHEBI:136357) |
| IUPAC Name |
|---|
| (7E,9E,11Z,13E,15R,17Z)-5,6,15-trihydroxyicosa-7,9,11,13,17-pentaenoic acid |
| Synonym | Source |
|---|---|
| (7E,9E,11Z,13E,15R,17Z)-5,6,15-trihydroxyeicosapentaenoic acid | ChEBI |
| Citations |
|---|