EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H38N2O11 |
| Net Charge | 0 |
| Average Mass | 614.648 |
| Monoisotopic Mass | 614.24756 |
| SMILES | COc1ccnc(C(=O)N[C@H]2COC(=O)[C@H](Cc3ccccc3)[C@@H](OC(=O)C(C)C)[C@H](C)OC2=O)c1OCOC(=O)C(C)C |
| InChI | InChI=1S/C31H38N2O11/c1-17(2)28(35)42-16-41-26-23(39-6)12-13-32-24(26)27(34)33-22-15-40-30(37)21(14-20-10-8-7-9-11-20)25(19(5)43-31(22)38)44-29(36)18(3)4/h7-13,17-19,21-22,25H,14-16H2,1-6H3,(H,33,34)/t19-,21+,22-,25-/m0/s1 |
| InChIKey | QGTOTYJSCYHYFK-RBODFLQRSA-N |
| Roles Classification |
|---|
| Biological Roles: | fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenpicoxamid (CHEBI:136340) has role agrochemical (CHEBI:33286) |
| fenpicoxamid (CHEBI:136340) is a acetal (CHEBI:59769) |
| fenpicoxamid (CHEBI:136340) is a antibiotic fungicide (CHEBI:87114) |
| fenpicoxamid (CHEBI:136340) is a lactone (CHEBI:25000) |
| fenpicoxamid (CHEBI:136340) is a pyridines (CHEBI:26421) |
| fenpicoxamid (CHEBI:136340) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (3S,6S,7R,8R)-8-benzyl-3-[({3-[(isobutyryloxy)methoxy]-4-methoxypyridin-2-yl}carbonyl)amino]-6-methyl-4,9-dioxo-1,5-dioxonan-7-yl 2-methylpropanoate |
| Synonyms | Source |
|---|---|
| Antibiotic UK 2A procide | ChemIDplus |
| UK 2A procide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Inatreq | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| fenpicoxamid | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21250066 | Reaxys |
| CAS:517875-34-2 | Alan Wood's Pesticides |