EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:136301 - L-α-(methylidenecyclopropyl)glycine
| Formula | C6H9NO2 |
| Net Charge | 0 |
| Average Mass | 127.143 |
| Monoisotopic Mass | 127.06333 |
| SMILES | C=C1CC1[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H9NO2/c1-3-2-4(3)5(7)6(8)9/h4-5H,1-2,7H2,(H,8,9)/t4?,5-/m0/s1 |
| InChIKey | MPIZVHPMGFWKMJ-AKGZTFGVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | phytotoxin Any toxin produced by a plant. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-α-(methylidenecyclopropyl)glycine (CHEBI:136301) has role phytotoxin (CHEBI:38231) |
| L-α-(methylidenecyclopropyl)glycine (CHEBI:136301) has role plant metabolite (CHEBI:76924) |
| L-α-(methylidenecyclopropyl)glycine (CHEBI:136301) is a cyclopropanes (CHEBI:51454) |
| L-α-(methylidenecyclopropyl)glycine (CHEBI:136301) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-α-(methylidenecyclopropyl)glycine (CHEBI:136301) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| (2S)-amino(2-methylenecyclopropyl)acetic acid |
| Synonyms | Source |
|---|---|
| MCPG | ChEBI |
| L-α-(methylenecyclopropyl)-glycine | ChEBI |
| α-(methylidenecyclopropyl)-L-glycine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-9757 | MetaCyc |
| Citations |
|---|