EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H44NO7P |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 501.594 |
| Monoisotopic Mass (excl. R groups) | 501.28554 |
| SMILES | *C(=O)OC[C@@H](O)COP(=O)(O)OCCN |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Papio hamadryas (ncbitaxon:9557) | - | MetaboLights (MTBLS426) |
| Roles Classification |
|---|
| Biological Roles: | Papio hamadryas metabolite Any mammalian metabolite produced during a metabolic reaction in Papio hamadryas. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lysophosphatidylethanolamine(20:4/0:0) (CHEBI:136143) has role Papio hamadryas metabolite (CHEBI:137684) |
| lysophosphatidylethanolamine(20:4/0:0) (CHEBI:136143) is a 1-acyl-sn-glycero-3-phosphoethanolamine (CHEBI:29017) |
| lysophosphatidylethanolamine(20:4/0:0) (CHEBI:136143) is a lysophosphatidylethanolamine 20:4 (CHEBI:64569) |
| Synonyms | Source |
|---|---|
| LPE(20:4/0:0) | ChEBI |
| PE(20:4/0:0) | ChEBI |