EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N2O9P |
| Net Charge | 0 |
| Average Mass | 324.182 |
| Monoisotopic Mass | 324.03587 |
| SMILES | O=c1ccn([C@@H]2O[C@H](CO)[C@@H](OP(=O)(O)O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H13N2O9P/c12-3-4-7(20-21(16,17)18)6(14)8(19-4)11-2-1-5(13)10-9(11)15/h1-2,4,6-8,12,14H,3H2,(H,10,13,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | FOGRQMPFHUHIGU-XVFCMESISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-UMP (CHEBI:28895) has role Escherichia coli metabolite (CHEBI:76971) |
| 3'-UMP (CHEBI:28895) is a pyrimidine ribonucleoside 3'-monophosphate (CHEBI:37018) |
| 3'-UMP (CHEBI:28895) is a uridine phosphate (CHEBI:27237) |
| 3'-UMP (CHEBI:28895) is conjugate acid of 3'-UMP(2−) (CHEBI:60784) |
| Incoming Relation(s) |
| 2'-deoxyuridine 3'-monophosphate (CHEBI:46322) has functional parent 3'-UMP (CHEBI:28895) |
| 3'-UMP(2−) (CHEBI:60784) is conjugate base of 3'-UMP (CHEBI:28895) |
| IUPAC Name |
|---|
| 3'-uridylic acid |
| Synonyms | Source |
|---|---|
| 3'-UMP | KEGG COMPOUND |
| 3'-uridinemonophosphate | DrugBank |
| uridine 3'-(dihydrogen phosphate) | ChemIDplus |
| uridine 3'-monophosphate | KEGG COMPOUND |
| uridine 3'-phosphate | KEGG COMPOUND |
| Citations |
|---|