EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H36N2O4 |
| Net Charge | 0 |
| Average Mass | 392.540 |
| Monoisotopic Mass | 392.26751 |
| SMILES | [H][C@]1(CC(=O)NCC(C)(C)N)CC[C@]2(CC1)OOC1(O2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C22H36N2O4/c1-20(2,23)13-24-19(25)12-14-3-5-21(6-4-14)26-22(28-27-21)17-8-15-7-16(10-17)11-18(22)9-15/h14-18H,3-13,23H2,1-2H3,(H,24,25)/t14-,15?,16?,17?,18?,21+,22? |
| InChIKey | VXYZBLXGCYNIHP-MMNSZCNZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| Applications: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arterolane (CHEBI:136054) has role antimalarial (CHEBI:38068) |
| arterolane (CHEBI:136054) has role antiplasmodial drug (CHEBI:64915) |
| arterolane (CHEBI:136054) is a adamantanes (CHEBI:51339) |
| arterolane (CHEBI:136054) is a oxaspiro compound (CHEBI:37948) |
| arterolane (CHEBI:136054) is a primary amino compound (CHEBI:50994) |
| arterolane (CHEBI:136054) is a secondary carboxamide (CHEBI:140325) |
| arterolane (CHEBI:136054) is a trioxolane (CHEBI:155930) |
| arterolane (CHEBI:136054) is conjugate base of arterolane(1+) (CHEBI:155928) |
| Incoming Relation(s) |
| arterolane(1+) (CHEBI:155928) is conjugate acid of arterolane (CHEBI:136054) |
| IUPAC Name |
|---|
| N-(2-amino-2-methylpropyl)-2-[(1s,4s)-dispiro[cyclohexane-1,3'-[1,2,4]trioxolane-5',2''-tricyclo[3.3.1.13,7]decan]-4-yl]acetamide |
| INNs | Source |
|---|---|
| arterolane | WHO MedNet |
| arterolano | WHO MedNet |
| arterolanum | WHO MedNet |
| artérolane | WHO MedNet |
| Synonyms | Source |
|---|---|
| OZ277 | DrugCentral |
| OZ 277 | ChemIDplus |
| RBx11160 | ChemIDplus |
| RBx-11160 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 5090 | DrugCentral |
| Arterolane | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:664338-39-0 | ChemIDplus |
| Citations |
|---|