EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N3O4 |
| Net Charge | 0 |
| Average Mass | 371.437 |
| Monoisotopic Mass | 371.18451 |
| SMILES | COc1c(N2C[C@@H](C)C[C@H](N)C2)ccc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C20H25N3O4/c1-11-7-12(21)9-22(8-11)16-6-5-14-17(19(16)27-2)23(13-3-4-13)10-15(18(14)24)20(25)26/h5-6,10-13H,3-4,7-9,21H2,1-2H3,(H,25,26)/t11-,12-/m0/s1 |
| InChIKey | AVPQPGFLVZTJOR-RYUDHWBXSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nemonoxacin (CHEBI:136053) has role antibacterial agent (CHEBI:33282) |
| nemonoxacin (CHEBI:136053) has role antiinfective agent (CHEBI:35441) |
| nemonoxacin (CHEBI:136053) has role antimicrobial agent (CHEBI:33281) |
| nemonoxacin (CHEBI:136053) has role renoprotective agent (CHEBI:231911) |
| nemonoxacin (CHEBI:136053) is a quinolines (CHEBI:26513) |
| INNs | Source |
|---|---|
| nemonoxacine | WHO MedNet |
| nemonoxacino | WHO MedNet |
| Synonyms | Source |
|---|---|
| Nemonoxacin | ChEMBL |
| taigexyn | DrugCentral |
| TG 873870 | DrugCentral |
| TG-873870 | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 5079 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:378746-64-6 | DrugCentral |
| Citations |
|---|