EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H32Cl2N2O5S |
| Net Charge | 0 |
| Average Mass | 591.557 |
| Monoisotopic Mass | 590.14090 |
| SMILES | CCCCCCO[C@@H](C)c1cccc(-c2csc(NC(=O)c3cc(Cl)c(/C=C(\C)C(=O)O)c(Cl)c3)n2)c1OC |
| InChI | InChI=1S/C29H32Cl2N2O5S/c1-5-6-7-8-12-38-18(3)20-10-9-11-21(26(20)37-4)25-16-39-29(32-25)33-27(34)19-14-23(30)22(24(31)15-19)13-17(2)28(35)36/h9-11,13-16,18H,5-8,12H2,1-4H3,(H,35,36)(H,32,33,34)/b17-13+/t18-/m0/s1 |
| InChIKey | NOZIJMHMKORZBA-KJCUYJGMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lusutrombopag (CHEBI:136051) is a cinnamic acids (CHEBI:23252) |
| Synonyms | Source |
|---|---|
| mulpleta | DrugCentral |
| S-888711 | DrugCentral |
| S 888711 | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 5059 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:1110766-97-6 | DrugCentral |