EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H37N5O5S |
| Net Charge | 0 |
| Average Mass | 531.679 |
| Monoisotopic Mass | 531.25154 |
| SMILES | CCCOc1ccc(S(=O)(=O)N2CCN(CCO)CC2)cc1-c1nc(=O)c2c(n1)c(CCC)cn2CC |
| InChI | InChI=1S/C26H37N5O5S/c1-4-7-19-18-30(6-3)24-23(19)27-25(28-26(24)33)21-17-20(8-9-22(21)36-16-5-2)37(34,35)31-12-10-29(11-13-31)14-15-32/h8-9,17-18,32H,4-7,10-16H2,1-3H3,(H,27,28,33) |
| InChIKey | MIJFNYMSCFYZNY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.1.4.35 (3',5'-cyclic-GMP phosphodiesterase) inhibitor An EC 3.1.4.* (phosphoric diester hydrolase) inhibitor that blocks the action of 3',5'-cyclic-GMP phosphodiesterase (EC 3.1.4.35). |
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mirodenafil (CHEBI:136049) has role EC 3.1.4.35 (3',5'-cyclic-GMP phosphodiesterase) inhibitor (CHEBI:71942) |
| mirodenafil (CHEBI:136049) has role vasodilator agent (CHEBI:35620) |
| mirodenafil (CHEBI:136049) is a N-alkylpiperazine (CHEBI:46845) |
| mirodenafil (CHEBI:136049) is a aromatic ether (CHEBI:35618) |
| mirodenafil (CHEBI:136049) is a primary alcohol (CHEBI:15734) |
| mirodenafil (CHEBI:136049) is a pyrrolopyrimidine (CHEBI:38670) |
| mirodenafil (CHEBI:136049) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 5-ethyl-2-(5-{[4-(2-hydroxyethyl)piperazin-1-yl]sulfonyl}-2-propoxyphenyl)-7-propyl-3,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one |
| INNs | Source |
|---|---|
| mirodenafil | WHO MedNet |
| mirodénafil | WHO MedNet |
| mirodenafilo | WHO MedNet |
| mirodenafilum | WHO MedNet |
| Synonyms | Source |
|---|---|
| SK-3530 | DrugBank |
| SK3530 | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 10173481 | ChemSpider |
| 5005 | DrugCentral |
| DB11792 | DrugBank |
| KR20080062434 | Patent |
| Mirodenafil | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:862189-95-5 | ChemIDplus |
| Citations |
|---|