EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16FN3O2S |
| Net Charge | 0 |
| Average Mass | 345.399 |
| Monoisotopic Mass | 345.09473 |
| SMILES | CNCc1cc(-c2ccccc2F)n(S(=O)(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C17H16FN3O2S/c1-19-10-13-9-17(15-6-2-3-7-16(15)18)21(12-13)24(22,23)14-5-4-8-20-11-14/h2-9,11-12,19H,10H2,1H3 |
| InChIKey | BFDBKMOZYNOTPK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vonoprazan (CHEBI:136048) has role anti-ulcer drug (CHEBI:49201) |
| vonoprazan (CHEBI:136048) has role antibacterial agent (CHEBI:33282) |
| vonoprazan (CHEBI:136048) is a pyrroles (CHEBI:26455) |
| Synonyms | Source |
|---|---|
| TAK-438 | DrugCentral |
| takecab | DrugCentral |
| Vonoprazan | ChEMBL |
| vonoprazan fumarate | DrugCentral |
| Brand Name | Source |
|---|---|
| Vocinti | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4993 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:881681-00-1 | DrugCentral |
| Citations |
|---|