EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H55N5O9S |
| Net Charge | 0 |
| Average Mass | 757.951 |
| Monoisotopic Mass | 757.37205 |
| SMILES | [H][C@@]12CN(C(=O)[C@]([H])(C(C)(C)C)NC(=O)OCC(C)(C)CCCCc3cccc4c3CN(C4)C(=O)O1)[C@]([H])(C(=O)N[C@]1(C(=O)NS(=O)(=O)C3CC3)C[C@@]1([H])CC)C2 |
| InChI | InChI=1S/C38H55N5O9S/c1-7-25-18-38(25,33(46)41-53(49,50)27-14-15-27)40-31(44)29-17-26-20-43(29)32(45)30(36(2,3)4)39-34(47)51-22-37(5,6)16-9-8-11-23-12-10-13-24-19-42(21-28(23)24)35(48)52-26/h10,12-13,25-27,29-30H,7-9,11,14-22H2,1-6H3,(H,39,47)(H,40,44)(H,41,46)/t25-,26-,29+,30-,38-/m1/s1 |
| InChIKey | KUQWGLQLLVFLSM-ONAXAZCASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | hepatitis C protease inhibitor An inhibitor of hepatitis C protease, an enzyme required for production of proteins needed for viral assembly. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vaniprevir (CHEBI:136047) has role antiviral drug (CHEBI:36044) |
| vaniprevir (CHEBI:136047) has role hepatitis C protease inhibitor (CHEBI:64924) |
| vaniprevir (CHEBI:136047) is a N-sulfonylcarboxamide (CHEBI:90852) |
| vaniprevir (CHEBI:136047) is a azamacrocycle (CHEBI:52898) |
| vaniprevir (CHEBI:136047) is a carbamate ester (CHEBI:23003) |
| vaniprevir (CHEBI:136047) is a cyclopropanes (CHEBI:51454) |
| vaniprevir (CHEBI:136047) is a pyrrolidinecarboxamide (CHEBI:46770) |
| IUPAC Name |
|---|
| (5R,7S,10S)-10-tert-butyl-N-{(1R,2R)-1-[(cyclopropylsulfonyl)carbamoyl]-2-ethylcyclopropyl}-15,15-dimethyl-3,9,12-trioxo-6,7,9,10,11,12,14,15,16,17,18,19-dodecahydro-1H,5H-2,23:5,8-dimethano-4,13,2,8,11-benzodioxatriazacyclohenicosine-7(3H)-carboxamide |
| INNs | Source |
|---|---|
| vaniprevirum | WHO MedNet |
| vaniprevir | WHO MedNet |
| vaniprevir | WHO MedNet |
| vaniprévir | WHO MedNet |
| Synonyms | Source |
|---|---|
| MK-7009 | ChemIDplus |
| MK7009 | ChemIDplus |
| MK 7009 | ChEBI |
| Brand Name | Source |
|---|---|
| Vanihep | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:923590-37-8 | ChemIDplus |
| Citations |
|---|