EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H31N7OS |
| Net Charge | 0 |
| Average Mass | 501.660 |
| Monoisotopic Mass | 501.23108 |
| SMILES | CCCCc1nc(C)c(CC(=S)N(C)C)c(=O)n1Cc1ccc(-c2ccccc2-c2nnnn2)cc1 |
| InChI | InChI=1S/C27H31N7OS/c1-5-6-11-24-28-18(2)23(16-25(36)33(3)4)27(35)34(24)17-19-12-14-20(15-13-19)21-9-7-8-10-22(21)26-29-31-32-30-26/h7-10,12-15H,5-6,11,16-17H2,1-4H3,(H,29,30,31,32) |
| InChIKey | AMEROGPZOLAFBN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anticholesteremic drug A substance used to lower plasma cholesterol levels. renoprotective agent Any compound that is able to prevent damage to the kidneys. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fimasartan (CHEBI:136044) has role anticholesteremic drug (CHEBI:35821) |
| fimasartan (CHEBI:136044) has role antihypertensive agent (CHEBI:35674) |
| fimasartan (CHEBI:136044) has role cardiovascular drug (CHEBI:35554) |
| fimasartan (CHEBI:136044) has role renoprotective agent (CHEBI:231911) |
| fimasartan (CHEBI:136044) is a biphenyls (CHEBI:22888) |
| Synonyms | Source |
|---|---|
| BR-A-657 | DrugCentral |
| Fimasartan | ChEMBL |
| fimasartan potassium | DrugCentral |
| fimasartan potassium hydrate | DrugCentral |
| fimasartan potassium trihydrate | DrugCentral |
| kanarb | DrugCentral |
| Brand Names | Source |
|---|---|
| Fimasartan component of br1015 | ChEMBL |
| Fimasartan component of br1019 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4906 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:247257-48-3 | DrugCentral |
| Citations |
|---|