EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H31N7OS |
| Net Charge | 0 |
| Average Mass | 501.660 |
| Monoisotopic Mass | 501.23108 |
| SMILES | CCCCc1nc(C)c(CC(=S)N(C)C)c(=O)n1Cc1ccc(-c2ccccc2-c2nnnn2)cc1 |
| InChI | InChI=1S/C27H31N7OS/c1-5-6-11-24-28-18(2)23(16-25(36)33(3)4)27(35)34(24)17-19-12-14-20(15-13-19)21-9-7-8-10-22(21)26-29-31-32-30-26/h7-10,12-15H,5-6,11,16-17H2,1-4H3,(H,29,30,31,32) |
| InChIKey | AMEROGPZOLAFBN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anticholesteremic drug A substance used to lower plasma cholesterol levels. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fimasartan (CHEBI:136044) has role anticholesteremic drug (CHEBI:35821) |
| fimasartan (CHEBI:136044) has role antihypertensive agent (CHEBI:35674) |
| fimasartan (CHEBI:136044) has role cardiovascular drug (CHEBI:35554) |
| fimasartan (CHEBI:136044) has role renoprotective agent (CHEBI:231911) |
| fimasartan (CHEBI:136044) is a biphenyls (CHEBI:22888) |
| Synonyms | Source |
|---|---|
| BR-A-657 | DrugCentral |
| Fimasartan | ChEMBL |
| fimasartan potassium | DrugCentral |
| fimasartan potassium hydrate | DrugCentral |
| fimasartan potassium trihydrate | DrugCentral |
| kanarb | DrugCentral |
| Brand Names | Source |
|---|---|
| Fimasartan component of br1015 | ChEMBL |
| Fimasartan component of br1019 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4906 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:247257-48-3 | DrugCentral |
| Citations |
|---|