EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O |
| Net Charge | 0 |
| Average Mass | 246.354 |
| Monoisotopic Mass | 246.17321 |
| SMILES | CCN(CC)C(=O)[C@@]1(c2ccccc2)C[C@H]1CN |
| InChI | InChI=1S/C15H22N2O/c1-3-17(4-2)14(18)15(10-13(15)11-16)12-8-6-5-7-9-12/h5-9,13H,3-4,10-11,16H2,1-2H3/t13-,15+/m0/s1 |
| InChIKey | GJJFMKBJSRMPLA-DZGCQCFKSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levomilnacipran (CHEBI:136040) has role antidepressant (CHEBI:35469) |
| levomilnacipran (CHEBI:136040) is a acetamides (CHEBI:22160) |
| Synonyms | Source |
|---|---|
| (1s,2r)-milnacipran | ChEMBL |
| F 2695 | ChEMBL |
| F-2695 | ChEMBL |
| F2695 | ChEMBL |
| fetzima | DrugCentral |
| Levomilnacipran | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4864 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:96847-54-0 | DrugCentral |
| Citations |
|---|