EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11NO3 |
| Net Charge | 0 |
| Average Mass | 253.257 |
| Monoisotopic Mass | 253.07389 |
| SMILES | O=C(O)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C15H11NO3/c17-14(18)9-16-12-7-3-1-5-10(12)15(19)11-6-2-4-8-13(11)16/h1-8H,9H2,(H,17,18) |
| InChIKey | UOMKBIIXHQIERR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cridanimod (CHEBI:136036) has functional parent acridone (CHEBI:50756) |
| cridanimod (CHEBI:136036) has role antineoplastic agent (CHEBI:35610) |
| cridanimod (CHEBI:136036) is a acridines (CHEBI:22213) |
| Synonyms | Source |
|---|---|
| Cridanimod | ChEMBL |
| neovir | DrugCentral |
| oxodihydroacridinylacetate sodium | DrugCentral |
| sodium cridanimod | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4853 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:38609-97-1 | DrugCentral |
| Citations |
|---|