EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9AsBiNO6 |
| Net Charge | 0 |
| Average Mass | 499.063 |
| Monoisotopic Mass | 498.94498 |
| SMILES | [O]=[Bi][O][As](=O)(O)c1ccc(NC(=O)CO)cc1 |
| InChI | InChI=1S/C8H10AsNO5.Bi.O/c11-5-8(12)10-7-3-1-6(2-4-7)9(13,14)15;;/h1-4,11H,5H2,(H,10,12)(H2,13,14,15);;/q;+1;/p-1 |
| InChIKey | FATAHBJTOKXSDH-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Application: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycobiarsol (CHEBI:136035) has role antiamoebic agent (CHEBI:171664) |
| glycobiarsol (CHEBI:136035) is a anilide (CHEBI:13248) |
| INN | Source |
|---|---|
| glicobiarsol | WHO MedNet |
| Synonyms | Source |
|---|---|
| bismuth glycollylarsanilate | DrugCentral |
| Glycobiarsol | ChEMBL |
| milibis | DrugCentral |
| NSC-221709 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4849 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:116-49-4 | DrugCentral |