EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C78H111N21O19 |
| Net Charge | 0 |
| Average Mass | 1646.874 |
| Monoisotopic Mass | 1645.83651 |
| SMILES | CCCC[C@H](NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(C)=O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1cncn1)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(N)=O)C(C)C |
| InChI | InChI=1S/C78H111N21O19/c1-5-6-19-52(91-75(116)61(41-101)97-72(113)57(34-46-24-26-49(103)27-25-46)94-74(115)60(40-100)88-44(4)102)68(109)92-54(28-29-64(105)106)70(111)96-59(36-48-38-83-42-87-48)73(114)93-56(33-45-16-8-7-9-17-45)71(112)90-53(22-14-31-84-78(81)82)69(110)95-58(35-47-37-85-51-20-11-10-18-50(47)51)67(108)86-39-63(104)89-55(21-12-13-30-79)77(118)99-32-15-23-62(99)76(117)98-65(43(2)3)66(80)107/h7-11,16-18,20,24-27,37-38,42-43,52-62,65,85,100-101,103H,5-6,12-15,19,21-23,28-36,39-41,79H2,1-4H3,(H2,80,107)(H,83,87)(H,86,108)(H,88,102)(H,89,104)(H,90,112)(H,91,116)(H,92,109)(H,93,114)(H,94,115)(H,95,110)(H,96,111)(H,97,113)(H,98,117)(H,105,106)(H4,81,82,84)/t52-,53-,54-,55-,56+,57-,58-,59-,60-,61-,62-,65-/m0/s1 |
| InChIKey | UAHFGYDRQSXQEB-LEBBXHLNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| afamelanotide (CHEBI:136034) has role dermatologic drug (CHEBI:50177) |
| afamelanotide (CHEBI:136034) is a polypeptide (CHEBI:15841) |
| IUPAC Name |
|---|
| N-acetyl-L-seryl-L-tyrosyl-L-seryl-L-norleucyl-L-α-glutamyl-L-histidyl-D-phenylalanyl-L-arginyl-L-tryptophylglycyl-L-lysyl-L-prolyl-L-valinamide |
| INNs | Source |
|---|---|
| afamelanotida | WHO MedNet |
| afamelanotidum | WHO MedNet |
| afamelanotide | WHO MedNet |
| afamélanotide | WHO MedNet |
| Synonyms | Source |
|---|---|
| melanotan I | ChemIDplus |
| CUV 1647 | ChemIDplus |
| CUV1647 | ChemIDplus |
| Nle4-D-Phe7-α-melanocyte-stimulating hormone | ChEBI |
| CUV-1647 | ChEBI |
| N-acteyl-L-Ser-L-Tyr-L-Ser-L-Nle-L-Glu-L-His-D-Phe-L-Arg-L-Trp-Gly-L-Lys-L-Pro-L-Val-NH2 | ChEBI |
| Brand Name | Source |
|---|---|
| Scenesse | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4836 | DrugCentral |
| DB04931 | DrugBank |
| D10511 | KEGG DRUG |
| Afamelanotide | Wikipedia |
| NZ554427 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:75921-69-6 | ChemIDplus |
| Citations |
|---|