EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O4 |
| Net Charge | 0 |
| Average Mass | 210.229 |
| Monoisotopic Mass | 210.08921 |
| SMILES | COC(=O)[C@@H]1[C@H](C(=O)OC)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C11H14O4/c1-14-10(12)8-6-3-4-7(5-6)9(8)11(13)15-2/h3-4,6-9H,5H2,1-2H3/t6-,7+,8-,9+ |
| InChIKey | VGQLNJWOULYVFV-SPJNRGJMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethylcarbate (CHEBI:136029) is a dicarboxylic acid (CHEBI:35692) |
| Synonyms | Source |
|---|---|
| dimalone | DrugCentral |
| dimethyl carbate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4770 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:39589-98-5 | DrugCentral |