EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32N2O5 |
| Net Charge | 0 |
| Average Mass | 476.573 |
| Monoisotopic Mass | 476.23112 |
| SMILES | [H][C@@]12Oc3c(O)ccc4c3[C@@]13CCN(CC1CC1)[C@]([H])(C4)[C@]3(O)CC[C@H]2N(C)C(=O)/C=C/c1ccoc1 |
| InChI | InChI=1S/C28H32N2O5/c1-29(23(32)7-4-18-9-13-34-16-18)20-8-10-28(33)22-14-19-5-6-21(31)25-24(19)27(28,26(20)35-25)11-12-30(22)15-17-2-3-17/h4-7,9,13,16-17,20,22,26,31,33H,2-3,8,10-12,14-15H2,1H3/b7-4+/t20-,22-,26+,27+,28-/m1/s1 |
| InChIKey | XGZZHZMWIXFATA-UEZBDDGYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nalfurafine (CHEBI:136019) is a phenanthrenes (CHEBI:25961) |
| Synonyms | Source |
|---|---|
| nalfurafine HCl | DrugCentral |
| nalfurafine hydrochloride | DrugCentral |
| remitch | DrugCentral |
| TRK-820 | DrugCentral |
| winfuran | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4673 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:152657-84-6 | DrugCentral |