EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N |
| Net Charge | 0 |
| Average Mass | 149.237 |
| Monoisotopic Mass | 149.12045 |
| SMILES | CN[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C10H15N/c1-9(11-2)8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3/t9-/m1/s1 |
| InChIKey | MYWUZJCMWCOHBA-SECBINFHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levmetamfetamine (CHEBI:136013) is a amphetamines (CHEBI:35338) |
| Incoming Relation(s) |
| N-(4-aminobutyl)-L-methamphetamine (CHEBI:235380) has functional parent levmetamfetamine (CHEBI:136013) |
| Synonyms | Source |
|---|---|
| (R)-Methylamphetamine | DrugCentral |
| l-Desoxyephedrine | DrugCentral |
| l-Methylamphetamine | DrugCentral |
| levomethamphetamine | DrugCentral |
| (R)-Methamphetamine | DrugCentral |
| L-Methamphetamine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4641 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:33817-09-3 | DrugCentral |