EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26NO4 |
| Net Charge | +1 |
| Average Mass | 356.442 |
| Monoisotopic Mass | 356.18563 |
| SMILES | [H][C@@]12Oc3c(O)ccc4c3[C@@]13CC[N+](C)(CC1CC1)[C@]([H])(C4)[C@]3(O)CCC2=O |
| InChI | InChI=1S/C21H25NO4/c1-22(11-12-2-3-12)9-8-20-17-13-4-5-14(23)18(17)26-19(20)15(24)6-7-21(20,25)16(22)10-13/h4-5,12,16,19,25H,2-3,6-11H2,1H3/p+1/t16-,19+,20+,21-,22?/m1/s1 |
| InChIKey | JVLBPIPGETUEET-GAAHOAFPSA-O |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylnaltrexone (CHEBI:136007) is a phenanthrenes (CHEBI:25961) |
| Synonyms | Source |
|---|---|
| methylnaltrexone bromide | DrugCentral |
| methylnaltrexonium | DrugCentral |
| relistor | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 4616 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:83387-25-1 | DrugCentral |