EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H22O14S4 |
| Net Charge | 0 |
| Average Mass | 494.540 |
| Monoisotopic Mass | 493.98924 |
| SMILES | CS(=O)(=O)OC[C@@H](OS(C)(=O)=O)[C@@H](O)[C@H](O)[C@@H](COS(C)(=O)=O)OS(C)(=O)=O |
| InChI | InChI=1S/C10H22O14S4/c1-25(13,14)21-5-7(23-27(3,17)18)9(11)10(12)8(24-28(4,19)20)6-22-26(2,15)16/h7-12H,5-6H2,1-4H3/t7-,8-,9-,10-/m1/s1 |
| InChIKey | UUVIQYKKKBJYJT-ZYUZMQFOSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mannosulfan (CHEBI:136005) has role antineoplastic agent (CHEBI:35610) |
| mannosulfan (CHEBI:136005) is a organosulfonic ester (CHEBI:83347) |
| INN | Source |
|---|---|
| manosulfano | WHO MedNet |
| Synonyms | Source |
|---|---|
| Mannosulfan | ChEMBL |
| R-52 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4598 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:7518-35-6 | DrugCentral |
| Citations |
|---|